C29H31ClFN4O4+ — CID 87170559
[(1R)-6-carboxyoxy-2,3-dihydro-1H-inden-1-yl]-(2-chloro-4-fluorobenzoyl)-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-methylazanium (PubChem CID 87170559) has the molecular formula C29H31ClFN4O4+ and a molecular weight of 554.04 g/mol. Its IUPAC name is [(1R)-6-carboxyoxy-2,3-dihydro-1H-inden-1-yl]-(2-chloro-4-fluorobenzoyl)-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-methylazanium.
| Compound Name | [(1R)-6-carboxyoxy-2,3-dihydro-1H-inden-1-yl]-(2-chloro-4-fluorobenzoyl)-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-methylazanium |
|---|---|
| PubChem CID | 87170559 |
| Molecular Formula | C29H31ClFN4O4+ |
| Molecular Weight | 554.04 g/mol |
| Exact Mass | 553.20 |
| IUPAC Name | [(1R)-6-carboxyoxy-2,3-dihydro-1H-inden-1-yl]-(2-chloro-4-fluorobenzoyl)-[1-(2,6-dimethylpyrimidin-4-yl)piperidin-4-yl]-methylazanium |
| SMILES | Cc1cc(N2CCC([N+](C)(C(=O)c3ccc(F)cc3Cl)[C@@H]3CCc4ccc(OC(=O)O)cc43)CC2)nc(C)n1 |
| InChI | InChI=1S/C29H30ClFN4O4/c1-17-14-27(33-18(2)32-17)34-12-10-21(11-13-34)35(3,28(36)23-8-6-20(31)15-25(23)30)26-9-5-19-4-7-22(16-24(19)26)39-29(37)38/h4,6-8,14-16,21,26H,5,9-13H2,1-3H3/p+1/t26-,35?/m1/s1 |
| InChIKey | UPVSHPTYCBSRPI-NAVQMUAQSA-O |
| XLogP | 5.89 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.04 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|