C29H31ClN3O4+ — CID 87170644
[(1R)-6-carboxyoxy-2,3-dihydro-1H-inden-1-yl]-(2-chlorobenzoyl)-methyl-[(1-pyridin-4-ylpiperidin-4-yl)methyl]azanium (PubChem CID 87170644) has the molecular formula C29H31ClN3O4+ and a molecular weight of 521.04 g/mol. Its IUPAC name is [(1R)-6-carboxyoxy-2,3-dihydro-1H-inden-1-yl]-(2-chlorobenzoyl)-methyl-[(1-pyridin-4-ylpiperidin-4-yl)methyl]azanium.
| Compound Name | [(1R)-6-carboxyoxy-2,3-dihydro-1H-inden-1-yl]-(2-chlorobenzoyl)-methyl-[(1-pyridin-4-ylpiperidin-4-yl)methyl]azanium |
|---|---|
| PubChem CID | 87170644 |
| Molecular Formula | C29H31ClN3O4+ |
| Molecular Weight | 521.04 g/mol |
| Exact Mass | 520.20 |
| IUPAC Name | [(1R)-6-carboxyoxy-2,3-dihydro-1H-inden-1-yl]-(2-chlorobenzoyl)-methyl-[(1-pyridin-4-ylpiperidin-4-yl)methyl]azanium |
| SMILES | C[N+](CC1CCN(c2ccncc2)CC1)(C(=O)c1ccccc1Cl)[C@@H]1CCc2ccc(OC(=O)O)cc21 |
| InChI | InChI=1S/C29H30ClN3O4/c1-33(28(34)24-4-2-3-5-26(24)30,19-20-12-16-32(17-13-20)22-10-14-31-15-11-22)27-9-7-21-6-8-23(18-25(21)27)37-29(35)36/h2-6,8,10-11,14-15,18,20,27H,7,9,12-13,16-17,19H2,1H3/p+1/t27-,33?/m1/s1 |
| InChIKey | UWLPIKDLMPMYQM-KOBZZRQBSA-O |
| XLogP | 5.98 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.04 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|