C27H32N3O5S+ — CID 87170778
(6-carboxyoxy-2,3-dihydro-1H-inden-1-yl)-ethylsulfonyl-(1-isoquinolin-6-ylpiperidin-4-yl)-methylazanium (PubChem CID 87170778) has the molecular formula C27H32N3O5S+ and a molecular weight of 510.64 g/mol. Its IUPAC name is (6-carboxyoxy-2,3-dihydro-1H-inden-1-yl)-ethylsulfonyl-(1-isoquinolin-6-ylpiperidin-4-yl)-methylazanium.
| Compound Name | (6-carboxyoxy-2,3-dihydro-1H-inden-1-yl)-ethylsulfonyl-(1-isoquinolin-6-ylpiperidin-4-yl)-methylazanium |
|---|---|
| PubChem CID | 87170778 |
| Molecular Formula | C27H32N3O5S+ |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | (6-carboxyoxy-2,3-dihydro-1H-inden-1-yl)-ethylsulfonyl-(1-isoquinolin-6-ylpiperidin-4-yl)-methylazanium |
| SMILES | CCS(=O)(=O)[N+](C)(C1CCN(c2ccc3cnccc3c2)CC1)C1CCc2ccc(OC(=O)O)cc21 |
| InChI | InChI=1S/C27H31N3O5S/c1-3-36(33,34)30(2,26-9-6-19-5-8-24(17-25(19)26)35-27(31)32)23-11-14-29(15-12-23)22-7-4-21-18-28-13-10-20(21)16-22/h4-5,7-8,10,13,16-18,23,26H,3,6,9,11-12,14-15H2,1-2H3/p+1 |
| InChIKey | YJUOWOSQURGEDZ-UHFFFAOYSA-O |
| XLogP | 4.74 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|