C31H42N3O4+ — CID 87170825
(6-carboxyoxy-2,3-dihydro-1H-inden-1-yl)-(3-cyclopentylpropanoyl)-[1-(2,6-dimethyl-4-pyridinyl)piperidin-4-yl]-methylazanium (PubChem CID 87170825) has the molecular formula C31H42N3O4+ and a molecular weight of 520.69 g/mol. Its IUPAC name is (6-carboxyoxy-2,3-dihydro-1H-inden-1-yl)-(3-cyclopentylpropanoyl)-[1-(2,6-dimethyl-4-pyridinyl)piperidin-4-yl]-methylazanium.
| Compound Name | (6-carboxyoxy-2,3-dihydro-1H-inden-1-yl)-(3-cyclopentylpropanoyl)-[1-(2,6-dimethyl-4-pyridinyl)piperidin-4-yl]-methylazanium |
|---|---|
| PubChem CID | 87170825 |
| Molecular Formula | C31H42N3O4+ |
| Molecular Weight | 520.69 g/mol |
| Exact Mass | 520.32 |
| IUPAC Name | (6-carboxyoxy-2,3-dihydro-1H-inden-1-yl)-(3-cyclopentylpropanoyl)-[1-(2,6-dimethyl-4-pyridinyl)piperidin-4-yl]-methylazanium |
| SMILES | Cc1cc(N2CCC([N+](C)(C(=O)CCC3CCCC3)C3CCc4ccc(OC(=O)O)cc43)CC2)cc(C)n1 |
| InChI | InChI=1S/C31H41N3O4/c1-21-18-25(19-22(2)32-21)33-16-14-26(15-17-33)34(3,30(35)13-8-23-6-4-5-7-23)29-12-10-24-9-11-27(20-28(24)29)38-31(36)37/h9,11,18-20,23,26,29H,4-8,10,12-17H2,1-3H3/p+1 |
| InChIKey | GVLISVNBUJYNJL-UHFFFAOYSA-O |
| XLogP | 6.36 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.69 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|