C27H36N3O4+ — CID 87170868
[(1R)-6-carboxyoxy-2,3-dihydro-1H-inden-1-yl]-methyl-(3-methylbutanoyl)-[1-(2-methyl-4-pyridinyl)piperidin-4-yl]azanium (PubChem CID 87170868) has the molecular formula C27H36N3O4+ and a molecular weight of 466.60 g/mol. Its IUPAC name is [(1R)-6-carboxyoxy-2,3-dihydro-1H-inden-1-yl]-methyl-(3-methylbutanoyl)-[1-(2-methyl-4-pyridinyl)piperidin-4-yl]azanium.
| Compound Name | [(1R)-6-carboxyoxy-2,3-dihydro-1H-inden-1-yl]-methyl-(3-methylbutanoyl)-[1-(2-methyl-4-pyridinyl)piperidin-4-yl]azanium |
|---|---|
| PubChem CID | 87170868 |
| Molecular Formula | C27H36N3O4+ |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | [(1R)-6-carboxyoxy-2,3-dihydro-1H-inden-1-yl]-methyl-(3-methylbutanoyl)-[1-(2-methyl-4-pyridinyl)piperidin-4-yl]azanium |
| SMILES | Cc1cc(N2CCC([N+](C)(C(=O)CC(C)C)[C@@H]3CCc4ccc(OC(=O)O)cc43)CC2)ccn1 |
| InChI | InChI=1S/C27H35N3O4/c1-18(2)15-26(31)30(4,22-10-13-29(14-11-22)21-9-12-28-19(3)16-21)25-8-6-20-5-7-23(17-24(20)25)34-27(32)33/h5,7,9,12,16-18,22,25H,6,8,10-11,13-15H2,1-4H3/p+1/t25-,30?/m1/s1 |
| InChIKey | ACTAKHYJURGQSQ-GOWJNXQMSA-O |
| XLogP | 5.12 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|