C33H30ClF3N3O4+ — CID 87170872
(6-carboxyoxy-2,3-dihydro-1H-inden-1-yl)-[2-chloro-3-(trifluoromethyl)benzoyl]-(1-isoquinolin-6-ylpiperidin-4-yl)-methylazanium (PubChem CID 87170872) has the molecular formula C33H30ClF3N3O4+ and a molecular weight of 625.07 g/mol. Its IUPAC name is (6-carboxyoxy-2,3-dihydro-1H-inden-1-yl)-[2-chloro-3-(trifluoromethyl)benzoyl]-(1-isoquinolin-6-ylpiperidin-4-yl)-methylazanium.
| Compound Name | (6-carboxyoxy-2,3-dihydro-1H-inden-1-yl)-[2-chloro-3-(trifluoromethyl)benzoyl]-(1-isoquinolin-6-ylpiperidin-4-yl)-methylazanium |
|---|---|
| PubChem CID | 87170872 |
| Molecular Formula | C33H30ClF3N3O4+ |
| Molecular Weight | 625.07 g/mol |
| Exact Mass | 624.19 |
| IUPAC Name | (6-carboxyoxy-2,3-dihydro-1H-inden-1-yl)-[2-chloro-3-(trifluoromethyl)benzoyl]-(1-isoquinolin-6-ylpiperidin-4-yl)-methylazanium |
| SMILES | C[N+](C(=O)c1cccc(C(F)(F)F)c1Cl)(C1CCN(c2ccc3cnccc3c2)CC1)C1CCc2ccc(OC(=O)O)cc21 |
| InChI | InChI=1S/C33H29ClF3N3O4/c1-40(31(41)26-3-2-4-28(30(26)34)33(35,36)37,29-10-7-20-6-9-25(18-27(20)29)44-32(42)43)24-12-15-39(16-13-24)23-8-5-22-19-38-14-11-21(22)17-23/h2-6,8-9,11,14,17-19,24,29H,7,10,12-13,15-16H2,1H3/p+1 |
| InChIKey | NHUSFUSNGXDMAR-UHFFFAOYSA-O |
| XLogP | 7.91 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.07 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|