C11H17F2NO4S — CID 87171098
2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-1,1-difluoro-2-oxoethanesulfonic acid (PubChem CID 87171098) has the molecular formula C11H17F2NO4S and a molecular weight of 297.32 g/mol. Its IUPAC name is 2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-1,1-difluoro-2-oxoethanesulfonic acid.
| Compound Name | 2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-1,1-difluoro-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 87171098 |
| Molecular Formula | C11H17F2NO4S |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 2-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-1,1-difluoro-2-oxoethanesulfonic acid |
| SMILES | O=C(N1CCCC2CCCCC21)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C11H17F2NO4S/c12-11(13,19(16,17)18)10(15)14-7-3-5-8-4-1-2-6-9(8)14/h8-9H,1-7H2,(H,16,17,18) |
| InChIKey | LLDQBVGFFLVCPH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|