About 3-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyboranylideneboranyloxy-2,3-dimethylbutan-2-ol
3-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyboranylideneboranyloxy-2,3-dimethylbutan-2-ol (PubChem CID 87171262) has the molecular formula C12H26B2O4
and a molecular weight of 255.96 g/mol. Its IUPAC name is 3-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyboranylideneboranyloxy-2,3-dimethylbutan-2-ol.
Molecular Properties
| Compound Name | 3-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyboranylideneboranyloxy-2,3-dimethylbutan-2-ol |
| PubChem CID | 87171262 |
| Molecular Formula | C12H26B2O4 |
| Molecular Weight | 255.96 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | 3-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyboranylideneboranyloxy-2,3-dimethylbutan-2-ol |
| SMILES | CC(C)(O)C(C)(C)O/B=B\OC(C)(C)C(C)(C)O |
| InChI | InChI=1S/C12H26B2O4/c1-9(2,15)11(5,6)17-13-14-18-12(7,8)10(3,4)16/h15-16H,1-8H3 |
| InChIKey | HLBIRJIPLXYWHO-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.96 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyboranylideneboranyloxy-2,3-dimethylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyboranylideneboranyloxy-2,3-dimethylbutan-2-ol?
The IUPAC name of 3-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyboranylideneboranyloxy-2,3-dimethylbutan-2-ol (CID 87171262) is 3-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyboranylideneboranyloxy-2,3-dimethylbutan-2-ol.
What is the SMILES notation for 3-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyboranylideneboranyloxy-2,3-dimethylbutan-2-ol?
The canonical SMILES for 3-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyboranylideneboranyloxy-2,3-dimethylbutan-2-ol is CC(C)(O)C(C)(C)O/B=B\OC(C)(C)C(C)(C)O.
What is the InChIKey of 3-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyboranylideneboranyloxy-2,3-dimethylbutan-2-ol?
The InChIKey is HLBIRJIPLXYWHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26B2O4/c1-9(2,15)11(5,6)17-13-14-18-12(7,8)10(3,4)16/h15-16H,1-8H3.
What are the key properties of 3-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyboranylideneboranyloxy-2,3-dimethylbutan-2-ol?
3-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyboranylideneboranyloxy-2,3-dimethylbutan-2-ol has a molecular weight of 255.96 g/mol, XLogP of 1.27, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-hydroxy-2,3-dimethylbutan-2-yl)oxyboranylideneboranyloxy-2,3-dimethylbutan-2-ol is sourced from PubChem (CID 87171262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).