About (12Z,15Z)-2-nonylhenicosa-12,15-dien-1-amine
(12Z,15Z)-2-nonylhenicosa-12,15-dien-1-amine (PubChem CID 87171499) has the molecular formula C30H59N
and a molecular weight of 433.81 g/mol. Its IUPAC name is (12Z,15Z)-2-nonylhenicosa-12,15-dien-1-amine.
Molecular Properties
| Compound Name | (12Z,15Z)-2-nonylhenicosa-12,15-dien-1-amine |
| PubChem CID | 87171499 |
| Molecular Formula | C30H59N |
| Molecular Weight | 433.81 g/mol |
| Exact Mass | 433.46 |
| IUPAC Name | (12Z,15Z)-2-nonylhenicosa-12,15-dien-1-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCCC(CN)CCCCCCCCC |
| InChI | InChI=1S/C30H59N/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-22-24-26-28-30(29-31)27-25-23-21-10-8-6-4-2/h11-12,14-15,30H,3-10,13,16-29,31H2,1-2H3/b12-11-,15-14- |
| InChIKey | DNQLCHGNWGEMHC-HDXUUTQWSA-N |
| XLogP | 10.30 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.81 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (12Z,15Z)-2-nonylhenicosa-12,15-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (12Z,15Z)-2-nonylhenicosa-12,15-dien-1-amine?
The IUPAC name of (12Z,15Z)-2-nonylhenicosa-12,15-dien-1-amine (CID 87171499) is (12Z,15Z)-2-nonylhenicosa-12,15-dien-1-amine.
What is the SMILES notation for (12Z,15Z)-2-nonylhenicosa-12,15-dien-1-amine?
The canonical SMILES for (12Z,15Z)-2-nonylhenicosa-12,15-dien-1-amine is CCCCC/C=C\C/C=C\CCCCCCCCCC(CN)CCCCCCCCC.
What is the InChIKey of (12Z,15Z)-2-nonylhenicosa-12,15-dien-1-amine?
The InChIKey is DNQLCHGNWGEMHC-HDXUUTQWSA-N. The full InChI is InChI=1S/C30H59N/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-22-24-26-28-30(29-31)27-25-23-21-10-8-6-4-2/h11-12,14-15,30H,3-10,13,16-29,31H2,1-2H3/b12-11-,15-14-.
What are the key properties of (12Z,15Z)-2-nonylhenicosa-12,15-dien-1-amine?
(12Z,15Z)-2-nonylhenicosa-12,15-dien-1-amine has a molecular weight of 433.81 g/mol, XLogP of 10.30, 25 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (12Z,15Z)-2-nonylhenicosa-12,15-dien-1-amine is sourced from PubChem (CID 87171499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).