About (1-methylpiperidin-4-yl)methyl 2-(iodoamino)propanoate
(1-methylpiperidin-4-yl)methyl 2-(iodoamino)propanoate (PubChem CID 87171656) has the molecular formula C10H19IN2O2
and a molecular weight of 326.18 g/mol. Its IUPAC name is (1-methylpiperidin-4-yl)methyl 2-(iodoamino)propanoate.
Molecular Properties
| Compound Name | (1-methylpiperidin-4-yl)methyl 2-(iodoamino)propanoate |
| PubChem CID | 87171656 |
| Molecular Formula | C10H19IN2O2 |
| Molecular Weight | 326.18 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | (1-methylpiperidin-4-yl)methyl 2-(iodoamino)propanoate |
| SMILES | CC(NI)C(=O)OCC1CCN(C)CC1 |
| InChI | InChI=1S/C10H19IN2O2/c1-8(12-11)10(14)15-7-9-3-5-13(2)6-4-9/h8-9,12H,3-7H2,1-2H3 |
| InChIKey | OSANUEFQMPPKFM-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.18 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze (1-methylpiperidin-4-yl)methyl 2-(iodoamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpiperidin-4-yl)methyl 2-(iodoamino)propanoate?
The IUPAC name of (1-methylpiperidin-4-yl)methyl 2-(iodoamino)propanoate (CID 87171656) is (1-methylpiperidin-4-yl)methyl 2-(iodoamino)propanoate.
What is the SMILES notation for (1-methylpiperidin-4-yl)methyl 2-(iodoamino)propanoate?
The canonical SMILES for (1-methylpiperidin-4-yl)methyl 2-(iodoamino)propanoate is CC(NI)C(=O)OCC1CCN(C)CC1.
What is the InChIKey of (1-methylpiperidin-4-yl)methyl 2-(iodoamino)propanoate?
The InChIKey is OSANUEFQMPPKFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19IN2O2/c1-8(12-11)10(14)15-7-9-3-5-13(2)6-4-9/h8-9,12H,3-7H2,1-2H3.
What are the key properties of (1-methylpiperidin-4-yl)methyl 2-(iodoamino)propanoate?
(1-methylpiperidin-4-yl)methyl 2-(iodoamino)propanoate has a molecular weight of 326.18 g/mol, XLogP of 1.20, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpiperidin-4-yl)methyl 2-(iodoamino)propanoate is sourced from PubChem (CID 87171656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).