C7H11N — CID 87171768
(1Z,3Z)-3-methylhexa-1,3,5-trien-1-amine (PubChem CID 87171768) has the molecular formula C7H11N and a molecular weight of 109.17 g/mol. Its IUPAC name is (1Z,3Z)-3-methylhexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3Z)-3-methylhexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 87171768 |
| Molecular Formula | C7H11N |
| Molecular Weight | 109.17 g/mol |
| Exact Mass | 109.09 |
| IUPAC Name | (1Z,3Z)-3-methylhexa-1,3,5-trien-1-amine |
| SMILES | C=C/C=C(C)\C=C/N |
| InChI | InChI=1S/C7H11N/c1-3-4-7(2)5-6-8/h3-6H,1,8H2,2H3/b6-5-,7-4- |
| InChIKey | SKEPVRADIMYUQC-RNPBPNGMSA-N |
| XLogP | 1.59 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 109.17 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|