C24H25ClN4O2 — CID 87171823
(E)-7-chloro-N-[3-[6-[(E)-N-methoxy-C-methylcarbonimidoyl]-2-pyridinyl]propoxy]-2,3-dihydro-1H-acridin-4-imine (PubChem CID 87171823) has the molecular formula C24H25ClN4O2 and a molecular weight of 436.94 g/mol. Its IUPAC name is (E)-7-chloro-N-[3-[6-[(E)-N-methoxy-C-methylcarbonimidoyl]-2-pyridinyl]propoxy]-2,3-dihydro-1H-acridin-4-imine.
| Compound Name | (E)-7-chloro-N-[3-[6-[(E)-N-methoxy-C-methylcarbonimidoyl]-2-pyridinyl]propoxy]-2,3-dihydro-1H-acridin-4-imine |
|---|---|
| PubChem CID | 87171823 |
| Molecular Formula | C24H25ClN4O2 |
| Molecular Weight | 436.94 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | (E)-7-chloro-N-[3-[6-[(E)-N-methoxy-C-methylcarbonimidoyl]-2-pyridinyl]propoxy]-2,3-dihydro-1H-acridin-4-imine |
| SMILES | CO/N=C(\C)c1cccc(CCCO/N=C2\CCCc3cc4cc(Cl)ccc4nc32)n1 |
| InChI | InChI=1S/C24H25ClN4O2/c1-16(28-30-2)21-9-4-7-20(26-21)8-5-13-31-29-23-10-3-6-17-14-18-15-19(25)11-12-22(18)27-24(17)23/h4,7,9,11-12,14-15H,3,5-6,8,10,13H2,1-2H3/b28-16+,29-23+ |
| InChIKey | WVTXEYVTKLBMTH-URUPHPBRSA-N |
| XLogP | 5.34 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.94 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|