About N-[benzyl(methyl)-λ4-sulfanylidene]-2,2,2-trifluoroacetamide
N-[benzyl(methyl)-λ4-sulfanylidene]-2,2,2-trifluoroacetamide (PubChem CID 87171874) has the molecular formula C10H10F3NOS
and a molecular weight of 249.26 g/mol. Its IUPAC name is N-[benzyl(methyl)-λ4-sulfanylidene]-2,2,2-trifluoroacetamide.
Molecular Properties
| Compound Name | N-[benzyl(methyl)-λ4-sulfanylidene]-2,2,2-trifluoroacetamide |
| PubChem CID | 87171874 |
| Molecular Formula | C10H10F3NOS |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | N-[benzyl(methyl)-λ4-sulfanylidene]-2,2,2-trifluoroacetamide |
| SMILES | C/S(Cc1ccccc1)=N\C(=O)C(F)(F)F |
| InChI | InChI=1S/C10H10F3NOS/c1-16(14-9(15)10(11,12)13)7-8-5-3-2-4-6-8/h2-6H,7H2,1H3 |
| InChIKey | QJWXGASPIDPETA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[benzyl(methyl)-λ4-sulfanylidene]-2,2,2-trifluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[benzyl(methyl)-λ4-sulfanylidene]-2,2,2-trifluoroacetamide?
The IUPAC name of N-[benzyl(methyl)-λ4-sulfanylidene]-2,2,2-trifluoroacetamide (CID 87171874) is N-[benzyl(methyl)-λ4-sulfanylidene]-2,2,2-trifluoroacetamide.
What is the SMILES notation for N-[benzyl(methyl)-λ4-sulfanylidene]-2,2,2-trifluoroacetamide?
The canonical SMILES for N-[benzyl(methyl)-λ4-sulfanylidene]-2,2,2-trifluoroacetamide is C/S(Cc1ccccc1)=N\C(=O)C(F)(F)F.
What is the InChIKey of N-[benzyl(methyl)-λ4-sulfanylidene]-2,2,2-trifluoroacetamide?
The InChIKey is QJWXGASPIDPETA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F3NOS/c1-16(14-9(15)10(11,12)13)7-8-5-3-2-4-6-8/h2-6H,7H2,1H3.
What are the key properties of N-[benzyl(methyl)-λ4-sulfanylidene]-2,2,2-trifluoroacetamide?
N-[benzyl(methyl)-λ4-sulfanylidene]-2,2,2-trifluoroacetamide has a molecular weight of 249.26 g/mol, XLogP of 2.71, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[benzyl(methyl)-λ4-sulfanylidene]-2,2,2-trifluoroacetamide is sourced from PubChem (CID 87171874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).