About N-[(4-aminophenyl)-cyclopropyl-oxo-λ6-sulfanylidene]-2,2,2-trifluoroacetamide
N-[(4-aminophenyl)-cyclopropyl-oxo-λ6-sulfanylidene]-2,2,2-trifluoroacetamide (PubChem CID 87171875) has the molecular formula C11H11F3N2O2S
and a molecular weight of 292.28 g/mol. Its IUPAC name is N-[(4-aminophenyl)-cyclopropyl-oxo-λ6-sulfanylidene]-2,2,2-trifluoroacetamide.
Molecular Properties
| Compound Name | N-[(4-aminophenyl)-cyclopropyl-oxo-λ6-sulfanylidene]-2,2,2-trifluoroacetamide |
| PubChem CID | 87171875 |
| Molecular Formula | C11H11F3N2O2S |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | N-[(4-aminophenyl)-cyclopropyl-oxo-λ6-sulfanylidene]-2,2,2-trifluoroacetamide |
| SMILES | Nc1ccc([S@@](=O)(=NC(=O)C(F)(F)F)C2CC2)cc1 |
| InChI | InChI=1S/C11H11F3N2O2S/c12-11(13,14)10(17)16-19(18,9-5-6-9)8-3-1-7(15)2-4-8/h1-4,9H,5-6,15H2/t19-/m0/s1 |
| InChIKey | GBBKUOJBAQLKJO-IBGZPJMESA-N |
| XLogP | 2.35 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze N-[(4-aminophenyl)-cyclopropyl-oxo-λ6-sulfanylidene]-2,2,2-trifluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-aminophenyl)-cyclopropyl-oxo-λ6-sulfanylidene]-2,2,2-trifluoroacetamide?
The IUPAC name of N-[(4-aminophenyl)-cyclopropyl-oxo-λ6-sulfanylidene]-2,2,2-trifluoroacetamide (CID 87171875) is N-[(4-aminophenyl)-cyclopropyl-oxo-λ6-sulfanylidene]-2,2,2-trifluoroacetamide.
What is the SMILES notation for N-[(4-aminophenyl)-cyclopropyl-oxo-λ6-sulfanylidene]-2,2,2-trifluoroacetamide?
The canonical SMILES for N-[(4-aminophenyl)-cyclopropyl-oxo-λ6-sulfanylidene]-2,2,2-trifluoroacetamide is Nc1ccc([S@@](=O)(=NC(=O)C(F)(F)F)C2CC2)cc1.
What is the InChIKey of N-[(4-aminophenyl)-cyclopropyl-oxo-λ6-sulfanylidene]-2,2,2-trifluoroacetamide?
The InChIKey is GBBKUOJBAQLKJO-IBGZPJMESA-N. The full InChI is InChI=1S/C11H11F3N2O2S/c12-11(13,14)10(17)16-19(18,9-5-6-9)8-3-1-7(15)2-4-8/h1-4,9H,5-6,15H2/t19-/m0/s1.
What are the key properties of N-[(4-aminophenyl)-cyclopropyl-oxo-λ6-sulfanylidene]-2,2,2-trifluoroacetamide?
N-[(4-aminophenyl)-cyclopropyl-oxo-λ6-sulfanylidene]-2,2,2-trifluoroacetamide has a molecular weight of 292.28 g/mol, XLogP of 2.35, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-aminophenyl)-cyclopropyl-oxo-λ6-sulfanylidene]-2,2,2-trifluoroacetamide is sourced from PubChem (CID 87171875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).