C25H27ClF2N6O — CID 87172044
2-[[5-chloro-2-[[7-(2,2-difluoroethylamino)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]amino]pyrimidin-4-yl]amino]-N-methylbenzamide (PubChem CID 87172044) has the molecular formula C25H27ClF2N6O and a molecular weight of 500.98 g/mol. Its IUPAC name is 2-[[5-chloro-2-[[7-(2,2-difluoroethylamino)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]amino]pyrimidin-4-yl]amino]-N-methylbenzamide.
| Compound Name | 2-[[5-chloro-2-[[7-(2,2-difluoroethylamino)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]amino]pyrimidin-4-yl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 87172044 |
| Molecular Formula | C25H27ClF2N6O |
| Molecular Weight | 500.98 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | 2-[[5-chloro-2-[[7-(2,2-difluoroethylamino)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-yl]amino]pyrimidin-4-yl]amino]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccccc1Nc1nc(Nc2ccc3c(c2)CCC(NCC(F)F)CC3)ncc1Cl |
| InChI | InChI=1S/C25H27ClF2N6O/c1-29-24(35)19-4-2-3-5-21(19)33-23-20(26)13-31-25(34-23)32-18-11-7-15-6-9-17(30-14-22(27)28)10-8-16(15)12-18/h2-5,7,11-13,17,22,30H,6,8-10,14H2,1H3,(H,29,35)(H2,31,32,33,34) |
| InChIKey | AXBDEWLWPITNDQ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 90.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.98 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |