C8H16O4 — CID 87172185
3-(ethoxymethyl)-7-methyl-1,2,5-trioxepane (PubChem CID 87172185) has the molecular formula C8H16O4 and a molecular weight of 176.21 g/mol. Its IUPAC name is 3-(ethoxymethyl)-7-methyl-1,2,5-trioxepane.
| Compound Name | 3-(ethoxymethyl)-7-methyl-1,2,5-trioxepane |
|---|---|
| PubChem CID | 87172185 |
| Molecular Formula | C8H16O4 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | 3-(ethoxymethyl)-7-methyl-1,2,5-trioxepane |
| SMILES | CCOCC1COCC(C)OO1 |
| InChI | InChI=1S/C8H16O4/c1-3-9-5-8-6-10-4-7(2)11-12-8/h7-8H,3-6H2,1-2H3 |
| InChIKey | GYJHJIMLOGQAMM-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|