About cis-(1S,3R)-cyclohexane-1,3-dicarbaldehyde
cis-(1S,3R)-cyclohexane-1,3-dicarbaldehyde (PubChem CID 87172253) has the molecular formula C8H12O2
and a molecular weight of 140.18 g/mol. Its IUPAC name is cis-(1S,3R)-cyclohexane-1,3-dicarbaldehyde.
Molecular Properties
| Compound Name | cis-(1S,3R)-cyclohexane-1,3-dicarbaldehyde |
| PubChem CID | 87172253 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | cis-(1S,3R)-cyclohexane-1,3-dicarbaldehyde |
| SMILES | O=C[C@@H]1CCC[C@H](C=O)C1 |
| InChI | InChI=1S/C8H12O2/c9-5-7-2-1-3-8(4-7)6-10/h5-8H,1-4H2/t7-,8+ |
| InChIKey | WHKHKMGAZGBKCK-OCAPTIKFSA-N |
| XLogP | 1.19 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze cis-(1S,3R)-cyclohexane-1,3-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,3R)-cyclohexane-1,3-dicarbaldehyde?
The IUPAC name of cis-(1S,3R)-cyclohexane-1,3-dicarbaldehyde (CID 87172253) is cis-(1S,3R)-cyclohexane-1,3-dicarbaldehyde.
What is the SMILES notation for cis-(1S,3R)-cyclohexane-1,3-dicarbaldehyde?
The canonical SMILES for cis-(1S,3R)-cyclohexane-1,3-dicarbaldehyde is O=C[C@@H]1CCC[C@H](C=O)C1.
What is the InChIKey of cis-(1S,3R)-cyclohexane-1,3-dicarbaldehyde?
The InChIKey is WHKHKMGAZGBKCK-OCAPTIKFSA-N. The full InChI is InChI=1S/C8H12O2/c9-5-7-2-1-3-8(4-7)6-10/h5-8H,1-4H2/t7-,8+.
What are the key properties of cis-(1S,3R)-cyclohexane-1,3-dicarbaldehyde?
cis-(1S,3R)-cyclohexane-1,3-dicarbaldehyde has a molecular weight of 140.18 g/mol, XLogP of 1.19, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,3R)-cyclohexane-1,3-dicarbaldehyde is sourced from PubChem (CID 87172253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).