About 3-[(1-amino-1-imino-2-methylpropan-2-yl)diazenyl]-2-methylpropanimidamide;hydrochloride
3-[(1-amino-1-imino-2-methylpropan-2-yl)diazenyl]-2-methylpropanimidamide;hydrochloride (PubChem CID 87172294) has the molecular formula C8H19ClN6
and a molecular weight of 234.74 g/mol. Its IUPAC name is 3-[(1-amino-1-imino-2-methylpropan-2-yl)diazenyl]-2-methylpropanimidamide;hydrochloride.
Molecular Properties
| Compound Name | 3-[(1-amino-1-imino-2-methylpropan-2-yl)diazenyl]-2-methylpropanimidamide;hydrochloride |
| PubChem CID | 87172294 |
| Molecular Formula | C8H19ClN6 |
| Molecular Weight | 234.74 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 3-[(1-amino-1-imino-2-methylpropan-2-yl)diazenyl]-2-methylpropanimidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)C(C)C/N=N/C(C)(C)/C(N)=N/[H] |
| InChI | InChI=1S/C8H18N6.ClH/c1-5(6(9)10)4-13-14-8(2,3)7(11)12;/h5H,4H2,1-3H3,(H3,9,10)(H3,11,12);1H/b14-13+; |
| InChIKey | XXAKEOANRWADPV-IERUDJENSA-N |
| XLogP | 1.15 |
| TPSA | 124.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.74 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1-amino-1-imino-2-methylpropan-2-yl)diazenyl]-2-methylpropanimidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1-amino-1-imino-2-methylpropan-2-yl)diazenyl]-2-methylpropanimidamide;hydrochloride?
The IUPAC name of 3-[(1-amino-1-imino-2-methylpropan-2-yl)diazenyl]-2-methylpropanimidamide;hydrochloride (CID 87172294) is 3-[(1-amino-1-imino-2-methylpropan-2-yl)diazenyl]-2-methylpropanimidamide;hydrochloride.
What is the SMILES notation for 3-[(1-amino-1-imino-2-methylpropan-2-yl)diazenyl]-2-methylpropanimidamide;hydrochloride?
The canonical SMILES for 3-[(1-amino-1-imino-2-methylpropan-2-yl)diazenyl]-2-methylpropanimidamide;hydrochloride is Cl.[H]/N=C(\N)C(C)C/N=N/C(C)(C)/C(N)=N/[H].
What is the InChIKey of 3-[(1-amino-1-imino-2-methylpropan-2-yl)diazenyl]-2-methylpropanimidamide;hydrochloride?
The InChIKey is XXAKEOANRWADPV-IERUDJENSA-N. The full InChI is InChI=1S/C8H18N6.ClH/c1-5(6(9)10)4-13-14-8(2,3)7(11)12;/h5H,4H2,1-3H3,(H3,9,10)(H3,11,12);1H/b14-13+;.
What are the key properties of 3-[(1-amino-1-imino-2-methylpropan-2-yl)diazenyl]-2-methylpropanimidamide;hydrochloride?
3-[(1-amino-1-imino-2-methylpropan-2-yl)diazenyl]-2-methylpropanimidamide;hydrochloride has a molecular weight of 234.74 g/mol, XLogP of 1.15, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1-amino-1-imino-2-methylpropan-2-yl)diazenyl]-2-methylpropanimidamide;hydrochloride is sourced from PubChem (CID 87172294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).