About ethene;1,1,2-trichloroethene
ethene;1,1,2-trichloroethene (PubChem CID 87172389) has the molecular formula C4H5Cl3
and a molecular weight of 159.44 g/mol. Its IUPAC name is ethene;1,1,2-trichloroethene.
Molecular Properties
| Compound Name | ethene;1,1,2-trichloroethene |
| PubChem CID | 87172389 |
| Molecular Formula | C4H5Cl3 |
| Molecular Weight | 159.44 g/mol |
| Exact Mass | 157.95 |
| IUPAC Name | ethene;1,1,2-trichloroethene |
| SMILES | C=C.ClC=C(Cl)Cl |
| InChI | InChI=1S/C2HCl3.C2H4/c3-1-2(4)5;1-2/h1H;1-2H2 |
| InChIKey | PUDVCCNQMBHJHA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;1,1,2-trichloroethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;1,1,2-trichloroethene?
The IUPAC name of ethene;1,1,2-trichloroethene (CID 87172389) is ethene;1,1,2-trichloroethene.
What is the SMILES notation for ethene;1,1,2-trichloroethene?
The canonical SMILES for ethene;1,1,2-trichloroethene is C=C.ClC=C(Cl)Cl.
What is the InChIKey of ethene;1,1,2-trichloroethene?
The InChIKey is PUDVCCNQMBHJHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C2HCl3.C2H4/c3-1-2(4)5;1-2/h1H;1-2H2.
What are the key properties of ethene;1,1,2-trichloroethene?
ethene;1,1,2-trichloroethene has a molecular weight of 159.44 g/mol, XLogP of 3.30, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;1,1,2-trichloroethene is sourced from PubChem (CID 87172389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).