C12H13F11O3 — CID 87172831
3,3,4,4,5,5,6,6,6-nonafluorohexyl 2,2-difluoro-3-hydroxy-4-methylpentanoate (PubChem CID 87172831) has the molecular formula C12H13F11O3 and a molecular weight of 414.21 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,6-nonafluorohexyl 2,2-difluoro-3-hydroxy-4-methylpentanoate.
| Compound Name | 3,3,4,4,5,5,6,6,6-nonafluorohexyl 2,2-difluoro-3-hydroxy-4-methylpentanoate |
|---|---|
| PubChem CID | 87172831 |
| Molecular Formula | C12H13F11O3 |
| Molecular Weight | 414.21 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 3,3,4,4,5,5,6,6,6-nonafluorohexyl 2,2-difluoro-3-hydroxy-4-methylpentanoate |
| SMILES | CC(C)C(O)C(F)(F)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H13F11O3/c1-5(2)6(24)9(15,16)7(25)26-4-3-8(13,14)10(17,18)11(19,20)12(21,22)23/h5-6,24H,3-4H2,1-2H3 |
| InChIKey | BFMMVADDYVCWBU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.21 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|