C10F20O2 — CID 87172990
[2-[1,2,2,3,3,4,4,5,5,6-decafluoro-6-(1,1,2,2-tetrafluoro-2-fluorooxyethyl)cyclohexyl]-1,1,2,2-tetrafluoroethyl] hypofluorite (PubChem CID 87172990) has the molecular formula C10F20O2 and a molecular weight of 532.07 g/mol. Its IUPAC name is [2-[1,2,2,3,3,4,4,5,5,6-decafluoro-6-(1,1,2,2-tetrafluoro-2-fluorooxyethyl)cyclohexyl]-1,1,2,2-tetrafluoroethyl] hypofluorite.
| Compound Name | [2-[1,2,2,3,3,4,4,5,5,6-decafluoro-6-(1,1,2,2-tetrafluoro-2-fluorooxyethyl)cyclohexyl]-1,1,2,2-tetrafluoroethyl] hypofluorite |
|---|---|
| PubChem CID | 87172990 |
| Molecular Formula | C10F20O2 |
| Molecular Weight | 532.07 g/mol |
| Exact Mass | 531.96 |
| IUPAC Name | [2-[1,2,2,3,3,4,4,5,5,6-decafluoro-6-(1,1,2,2-tetrafluoro-2-fluorooxyethyl)cyclohexyl]-1,1,2,2-tetrafluoroethyl] hypofluorite |
| SMILES | FOC(F)(F)C(F)(F)C1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)C(F)(F)C(F)(F)OF |
| InChI | InChI=1S/C10F20O2/c11-1(5(17,18)9(25,26)31-29)2(12,6(19,20)10(27,28)32-30)4(15,16)8(23,24)7(21,22)3(1,13)14 |
| InChIKey | NMVIQEWNYSMWCK-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.07 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|