C17H38O5 — CID 87173314
acetic acid;1-hexoxyhexane;propane-1,2-diol (PubChem CID 87173314) has the molecular formula C17H38O5 and a molecular weight of 322.49 g/mol. Its IUPAC name is acetic acid;1-hexoxyhexane;propane-1,2-diol.
| Compound Name | acetic acid;1-hexoxyhexane;propane-1,2-diol |
|---|---|
| PubChem CID | 87173314 |
| Molecular Formula | C17H38O5 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.27 |
| IUPAC Name | acetic acid;1-hexoxyhexane;propane-1,2-diol |
| SMILES | CC(=O)O.CC(O)CO.CCCCCCOCCCCCC |
| InChI | InChI=1S/C12H26O.C3H8O2.C2H4O2/c1-3-5-7-9-11-13-12-10-8-6-4-2;1-3(5)2-4;1-2(3)4/h3-12H2,1-2H3;3-5H,2H2,1H3;1H3,(H,3,4) |
| InChIKey | SFFDQGWHEGBYGK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|