C25H26F3NO6S — CID 87173516
[8-[2-(diethylamino)ethoxy]-6,6-dimethyl-11-oxonaphtho[2,3-b][1]benzofuran-3-yl] trifluoromethanesulfonate (PubChem CID 87173516) has the molecular formula C25H26F3NO6S and a molecular weight of 525.55 g/mol. Its IUPAC name is [8-[2-(diethylamino)ethoxy]-6,6-dimethyl-11-oxonaphtho[2,3-b][1]benzofuran-3-yl] trifluoromethanesulfonate.
| Compound Name | [8-[2-(diethylamino)ethoxy]-6,6-dimethyl-11-oxonaphtho[2,3-b][1]benzofuran-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87173516 |
| Molecular Formula | C25H26F3NO6S |
| Molecular Weight | 525.55 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | [8-[2-(diethylamino)ethoxy]-6,6-dimethyl-11-oxonaphtho[2,3-b][1]benzofuran-3-yl] trifluoromethanesulfonate |
| SMILES | CCN(CC)CCOc1ccc2c(c1)C(C)(C)c1oc3cc(OS(=O)(=O)C(F)(F)F)ccc3c1C2=O |
| InChI | InChI=1S/C25H26F3NO6S/c1-5-29(6-2)11-12-33-15-7-9-17-19(13-15)24(3,4)23-21(22(17)30)18-10-8-16(14-20(18)34-23)35-36(31,32)25(26,27)28/h7-10,13-14H,5-6,11-12H2,1-4H3 |
| InChIKey | NDJSGEGSJWBIEE-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.55 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|