About (12E,15E)-1-octoxyhenicosa-12,15-dien-2-amine
(12E,15E)-1-octoxyhenicosa-12,15-dien-2-amine (PubChem CID 87173663) has the molecular formula C29H57NO
and a molecular weight of 435.78 g/mol. Its IUPAC name is (12E,15E)-1-octoxyhenicosa-12,15-dien-2-amine.
Molecular Properties
| Compound Name | (12E,15E)-1-octoxyhenicosa-12,15-dien-2-amine |
| PubChem CID | 87173663 |
| Molecular Formula | C29H57NO |
| Molecular Weight | 435.78 g/mol |
| Exact Mass | 435.44 |
| IUPAC Name | (12E,15E)-1-octoxyhenicosa-12,15-dien-2-amine |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCCCC(N)COCCCCCCCC |
| InChI | InChI=1S/C29H57NO/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-21-22-24-26-29(30)28-31-27-25-23-10-8-6-4-2/h11-12,14-15,29H,3-10,13,16-28,30H2,1-2H3/b12-11+,15-14+ |
| InChIKey | LEUZBWPSYUMXHZ-TVYVBBRWSA-N |
| XLogP | 9.28 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.78 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (12E,15E)-1-octoxyhenicosa-12,15-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (12E,15E)-1-octoxyhenicosa-12,15-dien-2-amine?
The IUPAC name of (12E,15E)-1-octoxyhenicosa-12,15-dien-2-amine (CID 87173663) is (12E,15E)-1-octoxyhenicosa-12,15-dien-2-amine.
What is the SMILES notation for (12E,15E)-1-octoxyhenicosa-12,15-dien-2-amine?
The canonical SMILES for (12E,15E)-1-octoxyhenicosa-12,15-dien-2-amine is CCCCC/C=C/C/C=C/CCCCCCCCCC(N)COCCCCCCCC.
What is the InChIKey of (12E,15E)-1-octoxyhenicosa-12,15-dien-2-amine?
The InChIKey is LEUZBWPSYUMXHZ-TVYVBBRWSA-N. The full InChI is InChI=1S/C29H57NO/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-21-22-24-26-29(30)28-31-27-25-23-10-8-6-4-2/h11-12,14-15,29H,3-10,13,16-28,30H2,1-2H3/b12-11+,15-14+.
What are the key properties of (12E,15E)-1-octoxyhenicosa-12,15-dien-2-amine?
(12E,15E)-1-octoxyhenicosa-12,15-dien-2-amine has a molecular weight of 435.78 g/mol, XLogP of 9.28, 25 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (12E,15E)-1-octoxyhenicosa-12,15-dien-2-amine is sourced from PubChem (CID 87173663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).