C12H14Cl2N2O2 — CID 87174001
methyl 1-(2,6-dichloro-4-pyridinyl)piperidine-4-carboxylate (PubChem CID 87174001) has the molecular formula C12H14Cl2N2O2 and a molecular weight of 289.16 g/mol. Its IUPAC name is methyl 1-(2,6-dichloro-4-pyridinyl)piperidine-4-carboxylate.
| Compound Name | methyl 1-(2,6-dichloro-4-pyridinyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 87174001 |
| Molecular Formula | C12H14Cl2N2O2 |
| Molecular Weight | 289.16 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | methyl 1-(2,6-dichloro-4-pyridinyl)piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(c2cc(Cl)nc(Cl)c2)CC1 |
| InChI | InChI=1S/C12H14Cl2N2O2/c1-18-12(17)8-2-4-16(5-3-8)9-6-10(13)15-11(14)7-9/h6-8H,2-5H2,1H3 |
| InChIKey | HJNVPSCAUGSXSG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.16 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|