About diethoxy-methyl-(2,3,3-trimethylbutan-2-yloxy)silane
diethoxy-methyl-(2,3,3-trimethylbutan-2-yloxy)silane (PubChem CID 87174028) has the molecular formula C12H28O3Si
and a molecular weight of 248.44 g/mol. Its IUPAC name is diethoxy-methyl-(2,3,3-trimethylbutan-2-yloxy)silane.
Molecular Properties
| Compound Name | diethoxy-methyl-(2,3,3-trimethylbutan-2-yloxy)silane |
| PubChem CID | 87174028 |
| Molecular Formula | C12H28O3Si |
| Molecular Weight | 248.44 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | diethoxy-methyl-(2,3,3-trimethylbutan-2-yloxy)silane |
| SMILES | CCO[Si](C)(OCC)OC(C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H28O3Si/c1-9-13-16(8,14-10-2)15-12(6,7)11(3,4)5/h9-10H2,1-8H3 |
| InChIKey | SLNPQNVHYKLRLF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze diethoxy-methyl-(2,3,3-trimethylbutan-2-yloxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethoxy-methyl-(2,3,3-trimethylbutan-2-yloxy)silane?
The IUPAC name of diethoxy-methyl-(2,3,3-trimethylbutan-2-yloxy)silane (CID 87174028) is diethoxy-methyl-(2,3,3-trimethylbutan-2-yloxy)silane.
What is the SMILES notation for diethoxy-methyl-(2,3,3-trimethylbutan-2-yloxy)silane?
The canonical SMILES for diethoxy-methyl-(2,3,3-trimethylbutan-2-yloxy)silane is CCO[Si](C)(OCC)OC(C)(C)C(C)(C)C.
What is the InChIKey of diethoxy-methyl-(2,3,3-trimethylbutan-2-yloxy)silane?
The InChIKey is SLNPQNVHYKLRLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H28O3Si/c1-9-13-16(8,14-10-2)15-12(6,7)11(3,4)5/h9-10H2,1-8H3.
What are the key properties of diethoxy-methyl-(2,3,3-trimethylbutan-2-yloxy)silane?
diethoxy-methyl-(2,3,3-trimethylbutan-2-yloxy)silane has a molecular weight of 248.44 g/mol, XLogP of 3.47, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diethoxy-methyl-(2,3,3-trimethylbutan-2-yloxy)silane is sourced from PubChem (CID 87174028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).