About dimethyl-[3-(prop-2-enoylamino)propyl]azanium;propane-1-sulfonate
dimethyl-[3-(prop-2-enoylamino)propyl]azanium;propane-1-sulfonate (PubChem CID 87174130) has the molecular formula C11H24N2O4S
and a molecular weight of 280.39 g/mol. Its IUPAC name is dimethyl-[3-(prop-2-enoylamino)propyl]azanium;propane-1-sulfonate.
Molecular Properties
| Compound Name | dimethyl-[3-(prop-2-enoylamino)propyl]azanium;propane-1-sulfonate |
| PubChem CID | 87174130 |
| Molecular Formula | C11H24N2O4S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | dimethyl-[3-(prop-2-enoylamino)propyl]azanium;propane-1-sulfonate |
| SMILES | C=CC(=O)NCCC[NH+](C)C.CCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C8H16N2O.C3H8O3S/c1-4-8(11)9-6-5-7-10(2)3;1-2-3-7(4,5)6/h4H,1,5-7H2,2-3H3,(H,9,11);2-3H2,1H3,(H,4,5,6) |
| InChIKey | XZODTMKFUIRSME-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 90.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-[3-(prop-2-enoylamino)propyl]azanium;propane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-[3-(prop-2-enoylamino)propyl]azanium;propane-1-sulfonate?
The IUPAC name of dimethyl-[3-(prop-2-enoylamino)propyl]azanium;propane-1-sulfonate (CID 87174130) is dimethyl-[3-(prop-2-enoylamino)propyl]azanium;propane-1-sulfonate.
What is the SMILES notation for dimethyl-[3-(prop-2-enoylamino)propyl]azanium;propane-1-sulfonate?
The canonical SMILES for dimethyl-[3-(prop-2-enoylamino)propyl]azanium;propane-1-sulfonate is C=CC(=O)NCCC[NH+](C)C.CCCS(=O)(=O)[O-].
What is the InChIKey of dimethyl-[3-(prop-2-enoylamino)propyl]azanium;propane-1-sulfonate?
The InChIKey is XZODTMKFUIRSME-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O.C3H8O3S/c1-4-8(11)9-6-5-7-10(2)3;1-2-3-7(4,5)6/h4H,1,5-7H2,2-3H3,(H,9,11);2-3H2,1H3,(H,4,5,6).
What are the key properties of dimethyl-[3-(prop-2-enoylamino)propyl]azanium;propane-1-sulfonate?
dimethyl-[3-(prop-2-enoylamino)propyl]azanium;propane-1-sulfonate has a molecular weight of 280.39 g/mol, XLogP of -1.24, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-[3-(prop-2-enoylamino)propyl]azanium;propane-1-sulfonate is sourced from PubChem (CID 87174130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).