C28H36Cl2N4O2S2+2 — CID 87174246
2-chloro-6-[12-(3-chloro-2-formyl-5-methylsulfanylphenyl)-3,12-diaza-6,9-diazoniadispiro[5.2.59.26]hexadecan-3-yl]-4-(sulfanylmethyl)benzaldehyde (PubChem CID 87174246) has the molecular formula C28H36Cl2N4O2S2+2 and a molecular weight of 595.66 g/mol. Its IUPAC name is 2-chloro-6-[12-(3-chloro-2-formyl-5-methylsulfanylphenyl)-3,12-diaza-6,9-diazoniadispiro[5.2.59.26]hexadecan-3-yl]-4-(sulfanylmethyl)benzaldehyde.
| Compound Name | 2-chloro-6-[12-(3-chloro-2-formyl-5-methylsulfanylphenyl)-3,12-diaza-6,9-diazoniadispiro[5.2.59.26]hexadecan-3-yl]-4-(sulfanylmethyl)benzaldehyde |
|---|---|
| PubChem CID | 87174246 |
| Molecular Formula | C28H36Cl2N4O2S2+2 |
| Molecular Weight | 595.66 g/mol |
| Exact Mass | 594.16 |
| IUPAC Name | 2-chloro-6-[12-(3-chloro-2-formyl-5-methylsulfanylphenyl)-3,12-diaza-6,9-diazoniadispiro[5.2.59.26]hexadecan-3-yl]-4-(sulfanylmethyl)benzaldehyde |
| SMILES | CSc1cc(Cl)c(C=O)c(N2CC[N+]3(CC2)CC[N+]2(CCN(c4cc(CS)cc(Cl)c4C=O)CC2)CC3)c1 |
| InChI | InChI=1S/C28H35Cl2N4O2S2/c1-38-22-16-26(30)24(19-36)28(17-22)32-4-8-34(9-5-32)12-10-33(11-13-34)6-2-31(3-7-33)27-15-21(20-37)14-25(29)23(27)18-35/h14-19H,2-13,20H2,1H3/q+1/p+1 |
| InChIKey | AEMLOORNEUNRPQ-UHFFFAOYSA-O |
| XLogP | 4.76 |
| TPSA | 40.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.66 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|