About N-methyl-3-[[(9Z,12Z)-octadeca-9,12-dienoxy]methyl]dodecan-1-amine
N-methyl-3-[[(9Z,12Z)-octadeca-9,12-dienoxy]methyl]dodecan-1-amine (PubChem CID 87174254) has the molecular formula C32H63NO
and a molecular weight of 477.86 g/mol. Its IUPAC name is N-methyl-3-[[(9Z,12Z)-octadeca-9,12-dienoxy]methyl]dodecan-1-amine.
Molecular Properties
| Compound Name | N-methyl-3-[[(9Z,12Z)-octadeca-9,12-dienoxy]methyl]dodecan-1-amine |
| PubChem CID | 87174254 |
| Molecular Formula | C32H63NO |
| Molecular Weight | 477.86 g/mol |
| Exact Mass | 477.49 |
| IUPAC Name | N-methyl-3-[[(9Z,12Z)-octadeca-9,12-dienoxy]methyl]dodecan-1-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOCC(CCCCCCCCC)CCNC |
| InChI | InChI=1S/C32H63NO/c1-4-6-8-10-12-13-14-15-16-17-18-19-20-22-24-26-30-34-31-32(28-29-33-3)27-25-23-21-11-9-7-5-2/h12-13,15-16,32-33H,4-11,14,17-31H2,1-3H3/b13-12-,16-15- |
| InChIKey | KHVMMBHYMLAUDX-QGLGPCELSA-N |
| XLogP | 10.18 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 477.86 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-3-[[(9Z,12Z)-octadeca-9,12-dienoxy]methyl]dodecan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-3-[[(9Z,12Z)-octadeca-9,12-dienoxy]methyl]dodecan-1-amine?
The IUPAC name of N-methyl-3-[[(9Z,12Z)-octadeca-9,12-dienoxy]methyl]dodecan-1-amine (CID 87174254) is N-methyl-3-[[(9Z,12Z)-octadeca-9,12-dienoxy]methyl]dodecan-1-amine.
What is the SMILES notation for N-methyl-3-[[(9Z,12Z)-octadeca-9,12-dienoxy]methyl]dodecan-1-amine?
The canonical SMILES for N-methyl-3-[[(9Z,12Z)-octadeca-9,12-dienoxy]methyl]dodecan-1-amine is CCCCC/C=C\C/C=C\CCCCCCCCOCC(CCCCCCCCC)CCNC.
What is the InChIKey of N-methyl-3-[[(9Z,12Z)-octadeca-9,12-dienoxy]methyl]dodecan-1-amine?
The InChIKey is KHVMMBHYMLAUDX-QGLGPCELSA-N. The full InChI is InChI=1S/C32H63NO/c1-4-6-8-10-12-13-14-15-16-17-18-19-20-22-24-26-30-34-31-32(28-29-33-3)27-25-23-21-11-9-7-5-2/h12-13,15-16,32-33H,4-11,14,17-31H2,1-3H3/b13-12-,16-15-.
What are the key properties of N-methyl-3-[[(9Z,12Z)-octadeca-9,12-dienoxy]methyl]dodecan-1-amine?
N-methyl-3-[[(9Z,12Z)-octadeca-9,12-dienoxy]methyl]dodecan-1-amine has a molecular weight of 477.86 g/mol, XLogP of 10.18, 28 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-3-[[(9Z,12Z)-octadeca-9,12-dienoxy]methyl]dodecan-1-amine is sourced from PubChem (CID 87174254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).