C24H18N2O3S — CID 87174417
1-[(10E)-10-prop-2-enylidene-2,12-diazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,11,13,15,17,19-decaen-8-yl]ethanesulfonic acid (PubChem CID 87174417) has the molecular formula C24H18N2O3S and a molecular weight of 414.49 g/mol. Its IUPAC name is 1-[(10E)-10-prop-2-enylidene-2,12-diazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,11,13,15,17,19-decaen-8-yl]ethanesulfonic acid.
| Compound Name | 1-[(10E)-10-prop-2-enylidene-2,12-diazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,11,13,15,17,19-decaen-8-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 87174417 |
| Molecular Formula | C24H18N2O3S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 1-[(10E)-10-prop-2-enylidene-2,12-diazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,11,13,15,17,19-decaen-8-yl]ethanesulfonic acid |
| SMILES | C=C/C=C1/c2nc3cc4ccccc4cc3nc2-c2cccc(C(C)S(=O)(=O)O)c21 |
| InChI | InChI=1S/C24H18N2O3S/c1-3-7-18-22-17(14(2)30(27,28)29)10-6-11-19(22)24-23(18)25-20-12-15-8-4-5-9-16(15)13-21(20)26-24/h3-14H,1H2,2H3,(H,27,28,29)/b18-7+ |
| InChIKey | WWNXGFJIEPFUHD-CNHKJKLMSA-N |
| XLogP | 5.33 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|