C20H11NO3S — CID 87174504
5-oxo-20-thia-8-azapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1,3,6,9,11,13(21),14(19),15,17-nonaene-17-carboxylic acid (PubChem CID 87174504) has the molecular formula C20H11NO3S and a molecular weight of 345.38 g/mol. Its IUPAC name is 5-oxo-20-thia-8-azapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1,3,6,9,11,13(21),14(19),15,17-nonaene-17-carboxylic acid.
| Compound Name | 5-oxo-20-thia-8-azapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1,3,6,9,11,13(21),14(19),15,17-nonaene-17-carboxylic acid |
|---|---|
| PubChem CID | 87174504 |
| Molecular Formula | C20H11NO3S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | 5-oxo-20-thia-8-azapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1,3,6,9,11,13(21),14(19),15,17-nonaene-17-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)sc1c3ccc(=O)cc3[nH]c3cccc2c31 |
| InChI | InChI=1S/C20H11NO3S/c22-11-5-7-14-16(9-11)21-15-3-1-2-13-12-6-4-10(20(23)24)8-17(12)25-19(14)18(13)15/h1-9,21H,(H,23,24) |
| InChIKey | ZRVSKFPIEHTCDS-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|