C18H28N3O+ — CID 8717484
2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-N-[4-[(2S)-butan-2-yl]phenyl]acetamide (PubChem CID 8717484) has the molecular formula C18H28N3O+ and a molecular weight of 302.44 g/mol. Its IUPAC name is 2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-N-[4-[(2S)-butan-2-yl]phenyl]acetamide.
| Compound Name | 2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-N-[4-[(2S)-butan-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 8717484 |
| Molecular Formula | C18H28N3O+ |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)-N-[4-[(2S)-butan-2-yl]phenyl]acetamide |
| SMILES | CC[C@H](C)c1ccc(NC(=O)C[N+]23CCN(CC2)CC3)cc1 |
| InChI | InChI=1S/C18H27N3O/c1-3-15(2)16-4-6-17(7-5-16)19-18(22)14-21-11-8-20(9-12-21)10-13-21/h4-7,15H,3,8-14H2,1-2H3/p+1/t15-/m0/s1 |
| InChIKey | AGOPRYHVPSOGBV-HNNXBMFYSA-O |
| XLogP | 2.28 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|