C13H20O9 — CID 87174997
hepta-1,6-diene-4,4-diol;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 87174997) has the molecular formula C13H20O9 and a molecular weight of 320.29 g/mol. Its IUPAC name is hepta-1,6-diene-4,4-diol;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | hepta-1,6-diene-4,4-diol;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 87174997 |
| Molecular Formula | C13H20O9 |
| Molecular Weight | 320.29 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | hepta-1,6-diene-4,4-diol;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | C=CCC(O)(O)CC=C.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C7H12O2.C6H8O7/c1-3-5-7(8,9)6-4-2;7-3(8)1-6(13,5(11)12)2-4(9)10/h3-4,8-9H,1-2,5-6H2;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | RPLTXDWXIFABHW-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 172.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.29 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|