About butylazanium;butyl carbonate
butylazanium;butyl carbonate (PubChem CID 87175153) has the molecular formula C9H21NO3
and a molecular weight of 191.27 g/mol. Its IUPAC name is butylazanium;butyl carbonate.
Molecular Properties
| Compound Name | butylazanium;butyl carbonate |
| PubChem CID | 87175153 |
| Molecular Formula | C9H21NO3 |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.15 |
| IUPAC Name | butylazanium;butyl carbonate |
| SMILES | CCCCOC(=O)[O-].CCCC[NH3+] |
| InChI | InChI=1S/C5H10O3.C4H11N/c1-2-3-4-8-5(6)7;1-2-3-4-5/h2-4H2,1H3,(H,6,7);2-5H2,1H3 |
| InChIKey | SCJNFWUKTOYSRT-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butylazanium;butyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butylazanium;butyl carbonate?
The IUPAC name of butylazanium;butyl carbonate (CID 87175153) is butylazanium;butyl carbonate.
What is the SMILES notation for butylazanium;butyl carbonate?
The canonical SMILES for butylazanium;butyl carbonate is CCCCOC(=O)[O-].CCCC[NH3+].
What is the InChIKey of butylazanium;butyl carbonate?
The InChIKey is SCJNFWUKTOYSRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O3.C4H11N/c1-2-3-4-8-5(6)7;1-2-3-4-5/h2-4H2,1H3,(H,6,7);2-5H2,1H3.
What are the key properties of butylazanium;butyl carbonate?
butylazanium;butyl carbonate has a molecular weight of 191.27 g/mol, XLogP of 0.17, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butylazanium;butyl carbonate is sourced from PubChem (CID 87175153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).