About 2-methylpropylazanium;2-methylpropyl carbonate
2-methylpropylazanium;2-methylpropyl carbonate (PubChem CID 87175176) has the molecular formula C9H21NO3
and a molecular weight of 191.27 g/mol. Its IUPAC name is 2-methylpropylazanium;2-methylpropyl carbonate.
Molecular Properties
| Compound Name | 2-methylpropylazanium;2-methylpropyl carbonate |
| PubChem CID | 87175176 |
| Molecular Formula | C9H21NO3 |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.15 |
| IUPAC Name | 2-methylpropylazanium;2-methylpropyl carbonate |
| SMILES | CC(C)COC(=O)[O-].CC(C)C[NH3+] |
| InChI | InChI=1S/C5H10O3.C4H11N/c1-4(2)3-8-5(6)7;1-4(2)3-5/h4H,3H2,1-2H3,(H,6,7);4H,3,5H2,1-2H3 |
| InChIKey | SZVUQKOTOXVFTL-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylpropylazanium;2-methylpropyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropylazanium;2-methylpropyl carbonate?
The IUPAC name of 2-methylpropylazanium;2-methylpropyl carbonate (CID 87175176) is 2-methylpropylazanium;2-methylpropyl carbonate.
What is the SMILES notation for 2-methylpropylazanium;2-methylpropyl carbonate?
The canonical SMILES for 2-methylpropylazanium;2-methylpropyl carbonate is CC(C)COC(=O)[O-].CC(C)C[NH3+].
What is the InChIKey of 2-methylpropylazanium;2-methylpropyl carbonate?
The InChIKey is SZVUQKOTOXVFTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O3.C4H11N/c1-4(2)3-8-5(6)7;1-4(2)3-5/h4H,3H2,1-2H3,(H,6,7);4H,3,5H2,1-2H3.
What are the key properties of 2-methylpropylazanium;2-methylpropyl carbonate?
2-methylpropylazanium;2-methylpropyl carbonate has a molecular weight of 191.27 g/mol, XLogP of -0.11, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropylazanium;2-methylpropyl carbonate is sourced from PubChem (CID 87175176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).