C10H2F16O7 — CID 87175830
3-[2-[2-(2-carboxy-1,1,2,2-tetrafluoroethoxy)-1,1,2,2-tetrafluoroethoxy]-1,1,2,2-tetrafluoroethoxy]-2,2,3,3-tetrafluoropropanoic acid (PubChem CID 87175830) has the molecular formula C10H2F16O7 and a molecular weight of 538.09 g/mol. Its IUPAC name is 3-[2-[2-(2-carboxy-1,1,2,2-tetrafluoroethoxy)-1,1,2,2-tetrafluoroethoxy]-1,1,2,2-tetrafluoroethoxy]-2,2,3,3-tetrafluoropropanoic acid.
| Compound Name | 3-[2-[2-(2-carboxy-1,1,2,2-tetrafluoroethoxy)-1,1,2,2-tetrafluoroethoxy]-1,1,2,2-tetrafluoroethoxy]-2,2,3,3-tetrafluoropropanoic acid |
|---|---|
| PubChem CID | 87175830 |
| Molecular Formula | C10H2F16O7 |
| Molecular Weight | 538.09 g/mol |
| Exact Mass | 537.95 |
| IUPAC Name | 3-[2-[2-(2-carboxy-1,1,2,2-tetrafluoroethoxy)-1,1,2,2-tetrafluoroethoxy]-1,1,2,2-tetrafluoroethoxy]-2,2,3,3-tetrafluoropropanoic acid |
| SMILES | O=C(O)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(=O)O |
| InChI | InChI=1S/C10H2F16O7/c11-3(12,1(27)28)5(15,16)31-7(19,20)9(23,24)33-10(25,26)8(21,22)32-6(17,18)4(13,14)2(29)30/h(H,27,28)(H,29,30) |
| InChIKey | SWUPIHJLHSSNFJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.09 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|