C8H2F12O6 — CID 87176097
3-[2-(2-carboxy-1,1,2,2-tetrafluoroethoxy)-1,1,2,2-tetrafluoroethoxy]-2,2,3,3-tetrafluoropropanoic acid (PubChem CID 87176097) has the molecular formula C8H2F12O6 and a molecular weight of 422.07 g/mol. Its IUPAC name is 3-[2-(2-carboxy-1,1,2,2-tetrafluoroethoxy)-1,1,2,2-tetrafluoroethoxy]-2,2,3,3-tetrafluoropropanoic acid.
| Compound Name | 3-[2-(2-carboxy-1,1,2,2-tetrafluoroethoxy)-1,1,2,2-tetrafluoroethoxy]-2,2,3,3-tetrafluoropropanoic acid |
|---|---|
| PubChem CID | 87176097 |
| Molecular Formula | C8H2F12O6 |
| Molecular Weight | 422.07 g/mol |
| Exact Mass | 421.97 |
| IUPAC Name | 3-[2-(2-carboxy-1,1,2,2-tetrafluoroethoxy)-1,1,2,2-tetrafluoroethoxy]-2,2,3,3-tetrafluoropropanoic acid |
| SMILES | O=C(O)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(=O)O |
| InChI | InChI=1S/C8H2F12O6/c9-3(10,1(21)22)5(13,14)25-7(17,18)8(19,20)26-6(15,16)4(11,12)2(23)24/h(H,21,22)(H,23,24) |
| InChIKey | KQEIVOMVJGDVEA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.07 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|