About 2-[tert-butyl(dimethyl)silyl]ethenone;1,1-diethoxyethane
2-[tert-butyl(dimethyl)silyl]ethenone;1,1-diethoxyethane (PubChem CID 87176343) has the molecular formula C14H30O3Si
and a molecular weight of 274.48 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]ethenone;1,1-diethoxyethane.
Molecular Properties
| Compound Name | 2-[tert-butyl(dimethyl)silyl]ethenone;1,1-diethoxyethane |
| PubChem CID | 87176343 |
| Molecular Formula | C14H30O3Si |
| Molecular Weight | 274.48 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]ethenone;1,1-diethoxyethane |
| SMILES | CC(C)(C)[Si](C)(C)C=C=O.CCOC(C)OCC |
| InChI | InChI=1S/C8H16OSi.C6H14O2/c1-8(2,3)10(4,5)7-6-9;1-4-7-6(3)8-5-2/h7H,1-5H3;6H,4-5H2,1-3H3 |
| InChIKey | HJDYESWOMKTJSE-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.48 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze 2-[tert-butyl(dimethyl)silyl]ethenone;1,1-diethoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[tert-butyl(dimethyl)silyl]ethenone;1,1-diethoxyethane?
The IUPAC name of 2-[tert-butyl(dimethyl)silyl]ethenone;1,1-diethoxyethane (CID 87176343) is 2-[tert-butyl(dimethyl)silyl]ethenone;1,1-diethoxyethane.
What is the SMILES notation for 2-[tert-butyl(dimethyl)silyl]ethenone;1,1-diethoxyethane?
The canonical SMILES for 2-[tert-butyl(dimethyl)silyl]ethenone;1,1-diethoxyethane is CC(C)(C)[Si](C)(C)C=C=O.CCOC(C)OCC.
What is the InChIKey of 2-[tert-butyl(dimethyl)silyl]ethenone;1,1-diethoxyethane?
The InChIKey is HJDYESWOMKTJSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16OSi.C6H14O2/c1-8(2,3)10(4,5)7-6-9;1-4-7-6(3)8-5-2/h7H,1-5H3;6H,4-5H2,1-3H3.
What are the key properties of 2-[tert-butyl(dimethyl)silyl]ethenone;1,1-diethoxyethane?
2-[tert-butyl(dimethyl)silyl]ethenone;1,1-diethoxyethane has a molecular weight of 274.48 g/mol, XLogP of 3.83, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[tert-butyl(dimethyl)silyl]ethenone;1,1-diethoxyethane is sourced from PubChem (CID 87176343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).