About 4-[[1-(2,5-dioxo-3-sulfopyrrolidin-1-yl)-3-nitro-2H-pyridin-6-yl]disulfanyl]butanoic acid
4-[[1-(2,5-dioxo-3-sulfopyrrolidin-1-yl)-3-nitro-2H-pyridin-6-yl]disulfanyl]butanoic acid (PubChem CID 87177043) has the molecular formula C13H15N3O9S3
and a molecular weight of 453.48 g/mol. Its IUPAC name is 4-[[1-(2,5-dioxo-3-sulfopyrrolidin-1-yl)-3-nitro-2H-pyridin-6-yl]disulfanyl]butanoic acid.
Molecular Properties
| Compound Name | 4-[[1-(2,5-dioxo-3-sulfopyrrolidin-1-yl)-3-nitro-2H-pyridin-6-yl]disulfanyl]butanoic acid |
| PubChem CID | 87177043 |
| Molecular Formula | C13H15N3O9S3 |
| Molecular Weight | 453.48 g/mol |
| Exact Mass | 453.00 |
| IUPAC Name | 4-[[1-(2,5-dioxo-3-sulfopyrrolidin-1-yl)-3-nitro-2H-pyridin-6-yl]disulfanyl]butanoic acid |
| SMILES | O=C(O)CCCSSC1=CC=C([N+](=O)[O-])CN1N1C(=O)CC(S(=O)(=O)O)C1=O |
| InChI | InChI=1S/C13H15N3O9S3/c17-10-6-9(28(23,24)25)13(20)15(10)14-7-8(16(21)22)3-4-11(14)27-26-5-1-2-12(18)19/h3-4,9H,1-2,5-7H2,(H,18,19)(H,23,24,25) |
| InChIKey | COMWDIZLHZDYOI-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 175.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.48 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-[[1-(2,5-dioxo-3-sulfopyrrolidin-1-yl)-3-nitro-2H-pyridin-6-yl]disulfanyl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[1-(2,5-dioxo-3-sulfopyrrolidin-1-yl)-3-nitro-2H-pyridin-6-yl]disulfanyl]butanoic acid?
The IUPAC name of 4-[[1-(2,5-dioxo-3-sulfopyrrolidin-1-yl)-3-nitro-2H-pyridin-6-yl]disulfanyl]butanoic acid (CID 87177043) is 4-[[1-(2,5-dioxo-3-sulfopyrrolidin-1-yl)-3-nitro-2H-pyridin-6-yl]disulfanyl]butanoic acid.
What is the SMILES notation for 4-[[1-(2,5-dioxo-3-sulfopyrrolidin-1-yl)-3-nitro-2H-pyridin-6-yl]disulfanyl]butanoic acid?
The canonical SMILES for 4-[[1-(2,5-dioxo-3-sulfopyrrolidin-1-yl)-3-nitro-2H-pyridin-6-yl]disulfanyl]butanoic acid is O=C(O)CCCSSC1=CC=C([N+](=O)[O-])CN1N1C(=O)CC(S(=O)(=O)O)C1=O.
What is the InChIKey of 4-[[1-(2,5-dioxo-3-sulfopyrrolidin-1-yl)-3-nitro-2H-pyridin-6-yl]disulfanyl]butanoic acid?
The InChIKey is COMWDIZLHZDYOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O9S3/c17-10-6-9(28(23,24)25)13(20)15(10)14-7-8(16(21)22)3-4-11(14)27-26-5-1-2-12(18)19/h3-4,9H,1-2,5-7H2,(H,18,19)(H,23,24,25).
What are the key properties of 4-[[1-(2,5-dioxo-3-sulfopyrrolidin-1-yl)-3-nitro-2H-pyridin-6-yl]disulfanyl]butanoic acid?
4-[[1-(2,5-dioxo-3-sulfopyrrolidin-1-yl)-3-nitro-2H-pyridin-6-yl]disulfanyl]butanoic acid has a molecular weight of 453.48 g/mol, XLogP of 0.48, 9 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[1-(2,5-dioxo-3-sulfopyrrolidin-1-yl)-3-nitro-2H-pyridin-6-yl]disulfanyl]butanoic acid is sourced from PubChem (CID 87177043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).