About 1-[bromo(difluoro)methyl]-3-(difluoromethyl)-2,4,5,6-tetrafluorobenzene
1-[bromo(difluoro)methyl]-3-(difluoromethyl)-2,4,5,6-tetrafluorobenzene (PubChem CID 87177208) has the molecular formula C8HBrF8
and a molecular weight of 328.98 g/mol. Its IUPAC name is 1-[bromo(difluoro)methyl]-3-(difluoromethyl)-2,4,5,6-tetrafluorobenzene.
Molecular Properties
| Compound Name | 1-[bromo(difluoro)methyl]-3-(difluoromethyl)-2,4,5,6-tetrafluorobenzene |
| PubChem CID | 87177208 |
| Molecular Formula | C8HBrF8 |
| Molecular Weight | 328.98 g/mol |
| Exact Mass | 327.91 |
| IUPAC Name | 1-[bromo(difluoro)methyl]-3-(difluoromethyl)-2,4,5,6-tetrafluorobenzene |
| SMILES | Fc1c(F)c(C(F)F)c(F)c(C(F)(F)Br)c1F |
| InChI | InChI=1S/C8HBrF8/c9-8(16,17)2-3(10)1(7(14)15)4(11)6(13)5(2)12/h7H |
| InChIKey | MWIZDRZJSONQRP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.98 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[bromo(difluoro)methyl]-3-(difluoromethyl)-2,4,5,6-tetrafluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[bromo(difluoro)methyl]-3-(difluoromethyl)-2,4,5,6-tetrafluorobenzene?
The IUPAC name of 1-[bromo(difluoro)methyl]-3-(difluoromethyl)-2,4,5,6-tetrafluorobenzene (CID 87177208) is 1-[bromo(difluoro)methyl]-3-(difluoromethyl)-2,4,5,6-tetrafluorobenzene.
What is the SMILES notation for 1-[bromo(difluoro)methyl]-3-(difluoromethyl)-2,4,5,6-tetrafluorobenzene?
The canonical SMILES for 1-[bromo(difluoro)methyl]-3-(difluoromethyl)-2,4,5,6-tetrafluorobenzene is Fc1c(F)c(C(F)F)c(F)c(C(F)(F)Br)c1F.
What is the InChIKey of 1-[bromo(difluoro)methyl]-3-(difluoromethyl)-2,4,5,6-tetrafluorobenzene?
The InChIKey is MWIZDRZJSONQRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8HBrF8/c9-8(16,17)2-3(10)1(7(14)15)4(11)6(13)5(2)12/h7H.
What are the key properties of 1-[bromo(difluoro)methyl]-3-(difluoromethyl)-2,4,5,6-tetrafluorobenzene?
1-[bromo(difluoro)methyl]-3-(difluoromethyl)-2,4,5,6-tetrafluorobenzene has a molecular weight of 328.98 g/mol, XLogP of 4.62, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[bromo(difluoro)methyl]-3-(difluoromethyl)-2,4,5,6-tetrafluorobenzene is sourced from PubChem (CID 87177208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).