About 1-chlorobutane-1,4-diamine;hydrate
1-chlorobutane-1,4-diamine;hydrate (PubChem CID 87177656) has the molecular formula C4H13ClN2O
and a molecular weight of 140.61 g/mol. Its IUPAC name is 1-chlorobutane-1,4-diamine;hydrate.
Molecular Properties
| Compound Name | 1-chlorobutane-1,4-diamine;hydrate |
| PubChem CID | 87177656 |
| Molecular Formula | C4H13ClN2O |
| Molecular Weight | 140.61 g/mol |
| Exact Mass | 140.07 |
| IUPAC Name | 1-chlorobutane-1,4-diamine;hydrate |
| SMILES | NCCCC(N)Cl.O |
| InChI | InChI=1S/C4H11ClN2.H2O/c5-4(7)2-1-3-6;/h4H,1-3,6-7H2;1H2 |
| InChIKey | FHUUBWASVCEAOM-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.61 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-chlorobutane-1,4-diamine;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chlorobutane-1,4-diamine;hydrate?
The IUPAC name of 1-chlorobutane-1,4-diamine;hydrate (CID 87177656) is 1-chlorobutane-1,4-diamine;hydrate.
What is the SMILES notation for 1-chlorobutane-1,4-diamine;hydrate?
The canonical SMILES for 1-chlorobutane-1,4-diamine;hydrate is NCCCC(N)Cl.O.
What is the InChIKey of 1-chlorobutane-1,4-diamine;hydrate?
The InChIKey is FHUUBWASVCEAOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11ClN2.H2O/c5-4(7)2-1-3-6;/h4H,1-3,6-7H2;1H2.
What are the key properties of 1-chlorobutane-1,4-diamine;hydrate?
1-chlorobutane-1,4-diamine;hydrate has a molecular weight of 140.61 g/mol, XLogP of -0.58, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chlorobutane-1,4-diamine;hydrate is sourced from PubChem (CID 87177656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).