C13H29NO3S — CID 87177693
1-ethyl-3,3,5,5-tetramethylcyclohexan-1-amine;methanesulfonic acid (PubChem CID 87177693) has the molecular formula C13H29NO3S and a molecular weight of 279.45 g/mol. Its IUPAC name is 1-ethyl-3,3,5,5-tetramethylcyclohexan-1-amine;methanesulfonic acid.
| Compound Name | 1-ethyl-3,3,5,5-tetramethylcyclohexan-1-amine;methanesulfonic acid |
|---|---|
| PubChem CID | 87177693 |
| Molecular Formula | C13H29NO3S |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | 1-ethyl-3,3,5,5-tetramethylcyclohexan-1-amine;methanesulfonic acid |
| SMILES | CCC1(N)CC(C)(C)CC(C)(C)C1.CS(=O)(=O)O |
| InChI | InChI=1S/C12H25N.CH4O3S/c1-6-12(13)8-10(2,3)7-11(4,5)9-12;1-5(2,3)4/h6-9,13H2,1-5H3;1H3,(H,2,3,4) |
| InChIKey | HKZJSGBLHLPWSO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|