About 2-[1,7-bis(sulfanyl)-4-(3-sulfanylpropyl)heptan-4-yl]-3-(hydroxymethyl)butane-1,4-diol
2-[1,7-bis(sulfanyl)-4-(3-sulfanylpropyl)heptan-4-yl]-3-(hydroxymethyl)butane-1,4-diol (PubChem CID 87177951) has the molecular formula C15H32O3S3
and a molecular weight of 356.62 g/mol. Its IUPAC name is 2-[1,7-bis(sulfanyl)-4-(3-sulfanylpropyl)heptan-4-yl]-3-(hydroxymethyl)butane-1,4-diol.
Molecular Properties
| Compound Name | 2-[1,7-bis(sulfanyl)-4-(3-sulfanylpropyl)heptan-4-yl]-3-(hydroxymethyl)butane-1,4-diol |
| PubChem CID | 87177951 |
| Molecular Formula | C15H32O3S3 |
| Molecular Weight | 356.62 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 2-[1,7-bis(sulfanyl)-4-(3-sulfanylpropyl)heptan-4-yl]-3-(hydroxymethyl)butane-1,4-diol |
| SMILES | OCC(CO)C(CO)C(CCCS)(CCCS)CCCS |
| InChI | InChI=1S/C15H32O3S3/c16-10-13(11-17)14(12-18)15(4-1-7-19,5-2-8-20)6-3-9-21/h13-14,16-21H,1-12H2 |
| InChIKey | QHUGBOCKYKRDGC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.62 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[1,7-bis(sulfanyl)-4-(3-sulfanylpropyl)heptan-4-yl]-3-(hydroxymethyl)butane-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1,7-bis(sulfanyl)-4-(3-sulfanylpropyl)heptan-4-yl]-3-(hydroxymethyl)butane-1,4-diol?
The IUPAC name of 2-[1,7-bis(sulfanyl)-4-(3-sulfanylpropyl)heptan-4-yl]-3-(hydroxymethyl)butane-1,4-diol (CID 87177951) is 2-[1,7-bis(sulfanyl)-4-(3-sulfanylpropyl)heptan-4-yl]-3-(hydroxymethyl)butane-1,4-diol.
What is the SMILES notation for 2-[1,7-bis(sulfanyl)-4-(3-sulfanylpropyl)heptan-4-yl]-3-(hydroxymethyl)butane-1,4-diol?
The canonical SMILES for 2-[1,7-bis(sulfanyl)-4-(3-sulfanylpropyl)heptan-4-yl]-3-(hydroxymethyl)butane-1,4-diol is OCC(CO)C(CO)C(CCCS)(CCCS)CCCS.
What is the InChIKey of 2-[1,7-bis(sulfanyl)-4-(3-sulfanylpropyl)heptan-4-yl]-3-(hydroxymethyl)butane-1,4-diol?
The InChIKey is QHUGBOCKYKRDGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32O3S3/c16-10-13(11-17)14(12-18)15(4-1-7-19,5-2-8-20)6-3-9-21/h13-14,16-21H,1-12H2.
What are the key properties of 2-[1,7-bis(sulfanyl)-4-(3-sulfanylpropyl)heptan-4-yl]-3-(hydroxymethyl)butane-1,4-diol?
2-[1,7-bis(sulfanyl)-4-(3-sulfanylpropyl)heptan-4-yl]-3-(hydroxymethyl)butane-1,4-diol has a molecular weight of 356.62 g/mol, XLogP of 2.31, 14 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1,7-bis(sulfanyl)-4-(3-sulfanylpropyl)heptan-4-yl]-3-(hydroxymethyl)butane-1,4-diol is sourced from PubChem (CID 87177951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).