C13H8F13NO2 — CID 87178123
3-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)pyrrole-2,5-dione (PubChem CID 87178123) has the molecular formula C13H8F13NO2 and a molecular weight of 457.19 g/mol. Its IUPAC name is 3-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)pyrrole-2,5-dione.
| Compound Name | 3-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 87178123 |
| Molecular Formula | C13H8F13NO2 |
| Molecular Weight | 457.19 g/mol |
| Exact Mass | 457.03 |
| IUPAC Name | 3-(4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluorononyl)pyrrole-2,5-dione |
| SMILES | O=C1C=C(CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)N1 |
| InChI | InChI=1S/C13H8F13NO2/c14-8(15,3-1-2-5-4-6(28)27-7(5)29)9(16,17)10(18,19)11(20,21)12(22,23)13(24,25)26/h4H,1-3H2,(H,27,28,29) |
| InChIKey | NMGMSNWGZQBTLD-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.19 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|