C13H22O6 — CID 87178326
3-(3,3,3-triethoxypropyl)oxolane-2,5-dione (PubChem CID 87178326) has the molecular formula C13H22O6 and a molecular weight of 274.31 g/mol. Its IUPAC name is 3-(3,3,3-triethoxypropyl)oxolane-2,5-dione.
| Compound Name | 3-(3,3,3-triethoxypropyl)oxolane-2,5-dione |
|---|---|
| PubChem CID | 87178326 |
| Molecular Formula | C13H22O6 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 3-(3,3,3-triethoxypropyl)oxolane-2,5-dione |
| SMILES | CCOC(CCC1CC(=O)OC1=O)(OCC)OCC |
| InChI | InChI=1S/C13H22O6/c1-4-16-13(17-5-2,18-6-3)8-7-10-9-11(14)19-12(10)15/h10H,4-9H2,1-3H3 |
| InChIKey | KWWWJYZRDGGVBO-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|