C11H8F9NO2 — CID 87178390
3-(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)pyrrole-2,5-dione (PubChem CID 87178390) has the molecular formula C11H8F9NO2 and a molecular weight of 357.17 g/mol. Its IUPAC name is 3-(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)pyrrole-2,5-dione.
| Compound Name | 3-(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 87178390 |
| Molecular Formula | C11H8F9NO2 |
| Molecular Weight | 357.17 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 3-(4,4,5,5,6,6,7,7,7-nonafluoroheptyl)pyrrole-2,5-dione |
| SMILES | O=C1C=C(CCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)N1 |
| InChI | InChI=1S/C11H8F9NO2/c12-8(13,9(14,15)10(16,17)11(18,19)20)3-1-2-5-4-6(22)21-7(5)23/h4H,1-3H2,(H,21,22,23) |
| InChIKey | NAOFDMRKMBTKDC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.17 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|