About iron;2H-pyridin-2-ide-3,4-diimine
iron;2H-pyridin-2-ide-3,4-diimine (PubChem CID 87178769) has the molecular formula C5H4FeN3-
and a molecular weight of 161.95 g/mol. Its IUPAC name is iron;2H-pyridin-2-ide-3,4-diimine.
Molecular Properties
| Compound Name | iron;2H-pyridin-2-ide-3,4-diimine |
| PubChem CID | 87178769 |
| Molecular Formula | C5H4FeN3- |
| Molecular Weight | 161.95 g/mol |
| Exact Mass | 161.98 |
| IUPAC Name | iron;2H-pyridin-2-ide-3,4-diimine |
| SMILES | [Fe].[H]/N=C1\[C-]=NC=C\C1=N/[H] |
| InChI | InChI=1S/C5H4N3.Fe/c6-4-1-2-8-3-5(4)7;/h1-2,6-7H;/q-1;/b6-4+,7-5+; |
| InChIKey | APBALXLBFKLISJ-GWDFKRKCSA-N |
| XLogP | 0.50 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.95 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze iron;2H-pyridin-2-ide-3,4-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iron;2H-pyridin-2-ide-3,4-diimine?
The IUPAC name of iron;2H-pyridin-2-ide-3,4-diimine (CID 87178769) is iron;2H-pyridin-2-ide-3,4-diimine.
What is the SMILES notation for iron;2H-pyridin-2-ide-3,4-diimine?
The canonical SMILES for iron;2H-pyridin-2-ide-3,4-diimine is [Fe].[H]/N=C1\[C-]=NC=C\C1=N/[H].
What is the InChIKey of iron;2H-pyridin-2-ide-3,4-diimine?
The InChIKey is APBALXLBFKLISJ-GWDFKRKCSA-N. The full InChI is InChI=1S/C5H4N3.Fe/c6-4-1-2-8-3-5(4)7;/h1-2,6-7H;/q-1;/b6-4+,7-5+;.
What are the key properties of iron;2H-pyridin-2-ide-3,4-diimine?
iron;2H-pyridin-2-ide-3,4-diimine has a molecular weight of 161.95 g/mol, XLogP of 0.50, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for iron;2H-pyridin-2-ide-3,4-diimine is sourced from PubChem (CID 87178769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).