C14H21NO2 — CID 87179284
2-(2-methylpropylamino)oxy-3,4,4a,5-tetrahydro-2H-naphthalen-1-one (PubChem CID 87179284) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-(2-methylpropylamino)oxy-3,4,4a,5-tetrahydro-2H-naphthalen-1-one.
| Compound Name | 2-(2-methylpropylamino)oxy-3,4,4a,5-tetrahydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 87179284 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 2-(2-methylpropylamino)oxy-3,4,4a,5-tetrahydro-2H-naphthalen-1-one |
| SMILES | CC(C)CNOC1CCC2CC=CC=C2C1=O |
| InChI | InChI=1S/C14H21NO2/c1-10(2)9-15-17-13-8-7-11-5-3-4-6-12(11)14(13)16/h3-4,6,10-11,13,15H,5,7-9H2,1-2H3 |
| InChIKey | DLWUNNNDOYBWKC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|