C12H2F8S2 — CID 87179367
1,2,3,4-tetrafluoro-5-[(2,3,4,5-tetrafluorophenyl)disulfanyl]benzene (PubChem CID 87179367) has the molecular formula C12H2F8S2 and a molecular weight of 362.27 g/mol. Its IUPAC name is 1,2,3,4-tetrafluoro-5-[(2,3,4,5-tetrafluorophenyl)disulfanyl]benzene.
| Compound Name | 1,2,3,4-tetrafluoro-5-[(2,3,4,5-tetrafluorophenyl)disulfanyl]benzene |
|---|---|
| PubChem CID | 87179367 |
| Molecular Formula | C12H2F8S2 |
| Molecular Weight | 362.27 g/mol |
| Exact Mass | 361.95 |
| IUPAC Name | 1,2,3,4-tetrafluoro-5-[(2,3,4,5-tetrafluorophenyl)disulfanyl]benzene |
| SMILES | Fc1cc(SSc2cc(F)c(F)c(F)c2F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H2F8S2/c13-3-1-5(9(17)11(19)7(3)15)21-22-6-2-4(14)8(16)12(20)10(6)18/h1-2H |
| InChIKey | LKBLKVJLYUVBNY-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.27 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|