C26H16F6O2S2 — CID 87179812
1,2,3-trifluoro-4-methyl-5-phenoxy-6-[(2,3,4-trifluoro-5-methyl-6-phenoxyphenyl)disulfanyl]benzene (PubChem CID 87179812) has the molecular formula C26H16F6O2S2 and a molecular weight of 538.53 g/mol. Its IUPAC name is 1,2,3-trifluoro-4-methyl-5-phenoxy-6-[(2,3,4-trifluoro-5-methyl-6-phenoxyphenyl)disulfanyl]benzene.
| Compound Name | 1,2,3-trifluoro-4-methyl-5-phenoxy-6-[(2,3,4-trifluoro-5-methyl-6-phenoxyphenyl)disulfanyl]benzene |
|---|---|
| PubChem CID | 87179812 |
| Molecular Formula | C26H16F6O2S2 |
| Molecular Weight | 538.53 g/mol |
| Exact Mass | 538.05 |
| IUPAC Name | 1,2,3-trifluoro-4-methyl-5-phenoxy-6-[(2,3,4-trifluoro-5-methyl-6-phenoxyphenyl)disulfanyl]benzene |
| SMILES | Cc1c(F)c(F)c(F)c(SSc2c(F)c(F)c(F)c(C)c2Oc2ccccc2)c1Oc1ccccc1 |
| InChI | InChI=1S/C26H16F6O2S2/c1-13-17(27)19(29)21(31)25(23(13)33-15-9-5-3-6-10-15)35-36-26-22(32)20(30)18(28)14(2)24(26)34-16-11-7-4-8-12-16/h3-12H,1-2H3 |
| InChIKey | AMGITKATHNKZQU-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.53 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|